C22H34O7 — CID 175704292
benzene-1,2,4-tricarboxylic acid;11-methyldodecan-1-ol (PubChem CID 175704292) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is benzene-1,2,4-tricarboxylic acid;11-methyldodecan-1-ol.
| Compound Name | benzene-1,2,4-tricarboxylic acid;11-methyldodecan-1-ol |
|---|---|
| PubChem CID | 175704292 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | benzene-1,2,4-tricarboxylic acid;11-methyldodecan-1-ol |
| SMILES | CC(C)CCCCCCCCCCO.O=C(O)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H28O.C9H6O6/c1-13(2)11-9-7-5-3-4-6-8-10-12-14;10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15/h13-14H,3-12H2,1-2H3;1-3H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | MSDMMJGXADSRDA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|