C26H30O8 — CID 174963783
4-[1-(3,4-dicarboxyphenyl)-2,7-dimethyloctyl]phthalic acid (PubChem CID 174963783) has the molecular formula C26H30O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is 4-[1-(3,4-dicarboxyphenyl)-2,7-dimethyloctyl]phthalic acid.
| Compound Name | 4-[1-(3,4-dicarboxyphenyl)-2,7-dimethyloctyl]phthalic acid |
|---|---|
| PubChem CID | 174963783 |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 4-[1-(3,4-dicarboxyphenyl)-2,7-dimethyloctyl]phthalic acid |
| SMILES | CC(C)CCCCC(C)C(c1ccc(C(=O)O)c(C(=O)O)c1)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C26H30O8/c1-14(2)6-4-5-7-15(3)22(16-8-10-18(23(27)28)20(12-16)25(31)32)17-9-11-19(24(29)30)21(13-17)26(33)34/h8-15,22H,4-7H2,1-3H3,(H,27,28)(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | RNOAYYKDGNJFMN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|