C32H26O8 — CID 22709094
4-[[4-[1-[4-[(3,4-dicarboxyphenyl)methyl]phenyl]ethyl]phenyl]methyl]phthalic acid (PubChem CID 22709094) has the molecular formula C32H26O8 and a molecular weight of 538.55 g/mol. Its IUPAC name is 4-[[4-[1-[4-[(3,4-dicarboxyphenyl)methyl]phenyl]ethyl]phenyl]methyl]phthalic acid.
| Compound Name | 4-[[4-[1-[4-[(3,4-dicarboxyphenyl)methyl]phenyl]ethyl]phenyl]methyl]phthalic acid |
|---|---|
| PubChem CID | 22709094 |
| Molecular Formula | C32H26O8 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 4-[[4-[1-[4-[(3,4-dicarboxyphenyl)methyl]phenyl]ethyl]phenyl]methyl]phthalic acid |
| SMILES | CC(c1ccc(Cc2ccc(C(=O)O)c(C(=O)O)c2)cc1)c1ccc(Cc2ccc(C(=O)O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C32H26O8/c1-18(23-8-2-19(3-9-23)14-21-6-12-25(29(33)34)27(16-21)31(37)38)24-10-4-20(5-11-24)15-22-7-13-26(30(35)36)28(17-22)32(39)40/h2-13,16-18H,14-15H2,1H3,(H,33,34)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | OLZWHNJRTAGMIW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |