C34H24O16 — CID 158991172
3-[(2,3-dicarboxyphenyl)methyl]phthalic acid;4-[(3,4-dicarboxyphenyl)methyl]phthalic acid (PubChem CID 158991172) has the molecular formula C34H24O16 and a molecular weight of 688.55 g/mol. Its IUPAC name is 3-[(2,3-dicarboxyphenyl)methyl]phthalic acid;4-[(3,4-dicarboxyphenyl)methyl]phthalic acid.
| Compound Name | 3-[(2,3-dicarboxyphenyl)methyl]phthalic acid;4-[(3,4-dicarboxyphenyl)methyl]phthalic acid |
|---|---|
| PubChem CID | 158991172 |
| Molecular Formula | C34H24O16 |
| Molecular Weight | 688.55 g/mol |
| Exact Mass | 688.11 |
| IUPAC Name | 3-[(2,3-dicarboxyphenyl)methyl]phthalic acid;4-[(3,4-dicarboxyphenyl)methyl]phthalic acid |
| SMILES | O=C(O)c1ccc(Cc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O.O=C(O)c1cccc(Cc2cccc(C(=O)O)c2C(=O)O)c1C(=O)O |
| InChI | InChI=1S/2C17H12O8/c18-14(19)10-3-1-8(6-12(10)16(22)23)5-9-2-4-11(15(20)21)13(7-9)17(24)25;18-14(19)10-5-1-3-8(12(10)16(22)23)7-9-4-2-6-11(15(20)21)13(9)17(24)25/h1-4,6-7H,5H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25);1-6H,7H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | JQEGZKBWFRGCKT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 298.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |