C20H14O11 — CID 162070629
4-[2-[2-(3,4-dicarboxyphenyl)acetyl]oxy-2-oxoethyl]phthalic acid (PubChem CID 162070629) has the molecular formula C20H14O11 and a molecular weight of 430.32 g/mol. Its IUPAC name is 4-[2-[2-(3,4-dicarboxyphenyl)acetyl]oxy-2-oxoethyl]phthalic acid.
| Compound Name | 4-[2-[2-(3,4-dicarboxyphenyl)acetyl]oxy-2-oxoethyl]phthalic acid |
|---|---|
| PubChem CID | 162070629 |
| Molecular Formula | C20H14O11 |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 4-[2-[2-(3,4-dicarboxyphenyl)acetyl]oxy-2-oxoethyl]phthalic acid |
| SMILES | O=C(Cc1ccc(C(=O)O)c(C(=O)O)c1)OC(=O)Cc1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H14O11/c21-15(7-9-1-3-11(17(23)24)13(5-9)19(27)28)31-16(22)8-10-2-4-12(18(25)26)14(6-10)20(29)30/h1-6H,7-8H2,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | ZBAKXVLSEWVTLA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 192.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|