C9H10ClNO4 — CID 138040223
4-(aminomethyl)phthalic acid;hydrochloride (PubChem CID 138040223) has the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. Its IUPAC name is 4-(aminomethyl)phthalic acid;hydrochloride.
| Compound Name | 4-(aminomethyl)phthalic acid;hydrochloride |
|---|---|
| PubChem CID | 138040223 |
| Molecular Formula | C9H10ClNO4 |
| Molecular Weight | 231.63 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 4-(aminomethyl)phthalic acid;hydrochloride |
| SMILES | Cl.NCc1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H9NO4.ClH/c10-4-5-1-2-6(8(11)12)7(3-5)9(13)14;/h1-3H,4,10H2,(H,11,12)(H,13,14);1H |
| InChIKey | IGIXXNUZFBXJMC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.63 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |