C33H22N2O16 — CID 87859075
4-[(3,4-dicarboxyphenyl)diazenyl]phthalic acid;3-[(2,3-dicarboxyphenyl)methyl]phthalic acid (PubChem CID 87859075) has the molecular formula C33H22N2O16 and a molecular weight of 702.54 g/mol. Its IUPAC name is 4-[(3,4-dicarboxyphenyl)diazenyl]phthalic acid;3-[(2,3-dicarboxyphenyl)methyl]phthalic acid.
| Compound Name | 4-[(3,4-dicarboxyphenyl)diazenyl]phthalic acid;3-[(2,3-dicarboxyphenyl)methyl]phthalic acid |
|---|---|
| PubChem CID | 87859075 |
| Molecular Formula | C33H22N2O16 |
| Molecular Weight | 702.54 g/mol |
| Exact Mass | 702.10 |
| IUPAC Name | 4-[(3,4-dicarboxyphenyl)diazenyl]phthalic acid;3-[(2,3-dicarboxyphenyl)methyl]phthalic acid |
| SMILES | O=C(O)c1ccc(/N=N/c2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O.O=C(O)c1cccc(Cc2cccc(C(=O)O)c2C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C17H12O8.C16H10N2O8/c18-14(19)10-5-1-3-8(12(10)16(22)23)7-9-4-2-6-11(15(20)21)13(9)17(24)25;19-13(20)9-3-1-7(5-11(9)15(23)24)17-18-8-2-4-10(14(21)22)12(6-8)16(25)26/h1-6H,7H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25);1-6H,(H,19,20)(H,21,22)(H,23,24)(H,25,26)/b;18-17+ |
| InChIKey | ALCCMQVOQNNAKY-XRISSZCKSA-N |
| XLogP | 4.97 |
| TPSA | 323.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|