C16H12N2O7 — CID 174516752
4-[(3-carboxy-4-hydroxy-5-methylphenyl)diazenyl]phthalic acid (PubChem CID 174516752) has the molecular formula C16H12N2O7 and a molecular weight of 344.28 g/mol. Its IUPAC name is 4-[(3-carboxy-4-hydroxy-5-methylphenyl)diazenyl]phthalic acid.
| Compound Name | 4-[(3-carboxy-4-hydroxy-5-methylphenyl)diazenyl]phthalic acid |
|---|---|
| PubChem CID | 174516752 |
| Molecular Formula | C16H12N2O7 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 4-[(3-carboxy-4-hydroxy-5-methylphenyl)diazenyl]phthalic acid |
| SMILES | Cc1cc(/N=N/c2ccc(C(=O)O)c(C(=O)O)c2)cc(C(=O)O)c1O |
| InChI | InChI=1S/C16H12N2O7/c1-7-4-9(6-12(13(7)19)16(24)25)18-17-8-2-3-10(14(20)21)11(5-8)15(22)23/h2-6,19H,1H3,(H,20,21)(H,22,23)(H,24,25)/b18-17+ |
| InChIKey | HZRGSJDXIANNNO-ISLYRVAYSA-N |
| XLogP | 3.21 |
| TPSA | 156.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|