C20H14N2O7 — CID 135783962
4-[(2-hydroxy-3-methoxycarbonylnaphthalen-1-yl)diazenyl]phthalic acid (PubChem CID 135783962) has the molecular formula C20H14N2O7 and a molecular weight of 394.34 g/mol. Its IUPAC name is 4-[(2-hydroxy-3-methoxycarbonylnaphthalen-1-yl)diazenyl]phthalic acid.
| Compound Name | 4-[(2-hydroxy-3-methoxycarbonylnaphthalen-1-yl)diazenyl]phthalic acid |
|---|---|
| PubChem CID | 135783962 |
| Molecular Formula | C20H14N2O7 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 4-[(2-hydroxy-3-methoxycarbonylnaphthalen-1-yl)diazenyl]phthalic acid |
| SMILES | COC(=O)c1cc2ccccc2c(/N=N/c2ccc(C(=O)O)c(C(=O)O)c2)c1O |
| InChI | InChI=1S/C20H14N2O7/c1-29-20(28)15-8-10-4-2-3-5-12(10)16(17(15)23)22-21-11-6-7-13(18(24)25)14(9-11)19(26)27/h2-9,23H,1H3,(H,24,25)(H,26,27)/b22-21+ |
| InChIKey | PBPJYYQYSPYAGK-QURGRASLSA-N |
| XLogP | 4.14 |
| TPSA | 145.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|