C19H15N3O5 — CID 136706044
4-[(5-carbamoyl-2-methoxyphenyl)diazenyl]-3-hydroxynaphthalene-2-carboxylic acid (PubChem CID 136706044) has the molecular formula C19H15N3O5 and a molecular weight of 365.35 g/mol. Its IUPAC name is 4-[(5-carbamoyl-2-methoxyphenyl)diazenyl]-3-hydroxynaphthalene-2-carboxylic acid.
| Compound Name | 4-[(5-carbamoyl-2-methoxyphenyl)diazenyl]-3-hydroxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 136706044 |
| Molecular Formula | C19H15N3O5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 4-[(5-carbamoyl-2-methoxyphenyl)diazenyl]-3-hydroxynaphthalene-2-carboxylic acid |
| SMILES | COc1ccc(C(N)=O)cc1/N=N/c1c(O)c(C(=O)O)cc2ccccc12 |
| InChI | InChI=1S/C19H15N3O5/c1-27-15-7-6-11(18(20)24)9-14(15)21-22-16-12-5-3-2-4-10(12)8-13(17(16)23)19(25)26/h2-9,23H,1H3,(H2,20,24)(H,25,26)/b22-21+ |
| InChIKey | WWLDUWAYYIFTBU-QURGRASLSA-N |
| XLogP | 3.77 |
| TPSA | 134.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|