C32H24N6O5 — CID 136823060
3-hydroxy-N-(2-hydroxy-3H-benzimidazol-5-yl)-4-[[5-(C-hydroxy-N-phenylcarbonimidoyl)-2-methoxyphenyl]diazenyl]naphthalene-2-carboximidic acid (PubChem CID 136823060) has the molecular formula C32H24N6O5 and a molecular weight of 572.58 g/mol. Its IUPAC name is 3-hydroxy-N-(2-hydroxy-3H-benzimidazol-5-yl)-4-[[5-(C-hydroxy-N-phenylcarbonimidoyl)-2-methoxyphenyl]diazenyl]naphthalene-2-carboximidic acid.
| Compound Name | 3-hydroxy-N-(2-hydroxy-3H-benzimidazol-5-yl)-4-[[5-(C-hydroxy-N-phenylcarbonimidoyl)-2-methoxyphenyl]diazenyl]naphthalene-2-carboximidic acid |
|---|---|
| PubChem CID | 136823060 |
| Molecular Formula | C32H24N6O5 |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 3-hydroxy-N-(2-hydroxy-3H-benzimidazol-5-yl)-4-[[5-(C-hydroxy-N-phenylcarbonimidoyl)-2-methoxyphenyl]diazenyl]naphthalene-2-carboximidic acid |
| SMILES | COc1ccc(/C(O)=N/c2ccccc2)cc1/N=N/c1c(O)c(/C(O)=N/c2ccc3nc(O)[nH]c3c2)cc2ccccc12 |
| InChI | InChI=1S/C32H24N6O5/c1-43-27-14-11-19(30(40)33-20-8-3-2-4-9-20)16-26(27)37-38-28-22-10-6-5-7-18(22)15-23(29(28)39)31(41)34-21-12-13-24-25(17-21)36-32(42)35-24/h2-17,39H,1H3,(H,33,40)(H,34,41)(H2,35,36,42)/b38-37+ |
| InChIKey | LOGJDHWBDGLMNO-HEFFKOSUSA-N |
| XLogP | 7.82 |
| TPSA | 168.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|