C28H25N5O6 — CID 137293437
3-hydroxy-4-[[2-methoxy-5-(propan-2-ylcarbamoyl)phenyl]diazenyl]-N-(4-nitrophenyl)naphthalene-2-carboxamide (PubChem CID 137293437) has the molecular formula C28H25N5O6 and a molecular weight of 527.54 g/mol. Its IUPAC name is 3-hydroxy-4-[[2-methoxy-5-(propan-2-ylcarbamoyl)phenyl]diazenyl]-N-(4-nitrophenyl)naphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-4-[[2-methoxy-5-(propan-2-ylcarbamoyl)phenyl]diazenyl]-N-(4-nitrophenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 137293437 |
| Molecular Formula | C28H25N5O6 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 3-hydroxy-4-[[2-methoxy-5-(propan-2-ylcarbamoyl)phenyl]diazenyl]-N-(4-nitrophenyl)naphthalene-2-carboxamide |
| SMILES | COc1ccc(C(=O)NC(C)C)cc1/N=N/c1c(O)c(C(=O)Nc2ccc([N+](=O)[O-])cc2)cc2ccccc12 |
| InChI | InChI=1S/C28H25N5O6/c1-16(2)29-27(35)18-8-13-24(39-3)23(15-18)31-32-25-21-7-5-4-6-17(21)14-22(26(25)34)28(36)30-19-9-11-20(12-10-19)33(37)38/h4-16,34H,1-3H3,(H,29,35)(H,30,36)/b32-31+ |
| InChIKey | RXMJPSJTZCVSBK-QNEJGDQOSA-N |
| XLogP | 6.27 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|