C27H23N5O6 — CID 137304865
4-[[5-(ethylcarbamoyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide (PubChem CID 137304865) has the molecular formula C27H23N5O6 and a molecular weight of 513.51 g/mol. Its IUPAC name is 4-[[5-(ethylcarbamoyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide.
| Compound Name | 4-[[5-(ethylcarbamoyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 137304865 |
| Molecular Formula | C27H23N5O6 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 4-[[5-(ethylcarbamoyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide |
| SMILES | CCNC(=O)c1ccc(OC)c(/N=N/c2c(O)c(C(=O)Nc3cccc([N+](=O)[O-])c3)cc3ccccc23)c1 |
| InChI | InChI=1S/C27H23N5O6/c1-3-28-26(34)17-11-12-23(38-2)22(14-17)30-31-24-20-10-5-4-7-16(20)13-21(25(24)33)27(35)29-18-8-6-9-19(15-18)32(36)37/h4-15,33H,3H2,1-2H3,(H,28,34)(H,29,35)/b31-30+ |
| InChIKey | RRNCDNINGDQJGK-NVQSTNCTSA-N |
| XLogP | 5.88 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|