C26H21N5O6 — CID 137293433
3-hydroxy-4-[[2-methoxy-4-(methylcarbamoyl)phenyl]diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide (PubChem CID 137293433) has the molecular formula C26H21N5O6 and a molecular weight of 499.48 g/mol. Its IUPAC name is 3-hydroxy-4-[[2-methoxy-4-(methylcarbamoyl)phenyl]diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-4-[[2-methoxy-4-(methylcarbamoyl)phenyl]diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 137293433 |
| Molecular Formula | C26H21N5O6 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 3-hydroxy-4-[[2-methoxy-4-(methylcarbamoyl)phenyl]diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide |
| SMILES | CNC(=O)c1ccc(/N=N/c2c(O)c(C(=O)Nc3cccc([N+](=O)[O-])c3)cc3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C26H21N5O6/c1-27-25(33)16-10-11-21(22(13-16)37-2)29-30-23-19-9-4-3-6-15(19)12-20(24(23)32)26(34)28-17-7-5-8-18(14-17)31(35)36/h3-14,32H,1-2H3,(H,27,33)(H,28,34)/b30-29+ |
| InChIKey | IXNIFQCOXKZTOF-QVIHXGFCSA-N |
| XLogP | 5.49 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|