C32H26N4O5 — CID 177440661
4-[(4-benzamido-3,5-dimethoxyphenyl)diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide (PubChem CID 177440661) has the molecular formula C32H26N4O5 and a molecular weight of 546.58 g/mol. Its IUPAC name is 4-[(4-benzamido-3,5-dimethoxyphenyl)diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide.
| Compound Name | 4-[(4-benzamido-3,5-dimethoxyphenyl)diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 177440661 |
| Molecular Formula | C32H26N4O5 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 4-[(4-benzamido-3,5-dimethoxyphenyl)diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
| SMILES | COc1cc(/N=N/c2c(O)c(C(=O)Nc3ccccc3)cc3ccccc23)cc(OC)c1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H26N4O5/c1-40-26-18-23(19-27(41-2)29(26)34-31(38)20-11-5-3-6-12-20)35-36-28-24-16-10-9-13-21(24)17-25(30(28)37)32(39)33-22-14-7-4-8-15-22/h3-19,37H,1-2H3,(H,33,39)(H,34,38)/b36-35+ |
| InChIKey | GVDAGSPWVKYJBZ-ULDVOPSXSA-N |
| XLogP | 7.48 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|