C34H29N5O5 — CID 137119809
N-(4-acetamido-2-methylphenyl)-3-hydroxy-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl]naphthalene-2-carboxamide (PubChem CID 137119809) has the molecular formula C34H29N5O5 and a molecular weight of 587.64 g/mol. Its IUPAC name is N-(4-acetamido-2-methylphenyl)-3-hydroxy-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl]naphthalene-2-carboxamide.
| Compound Name | N-(4-acetamido-2-methylphenyl)-3-hydroxy-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 137119809 |
| Molecular Formula | C34H29N5O5 |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | N-(4-acetamido-2-methylphenyl)-3-hydroxy-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl]naphthalene-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2)cc1/N=N/c1c(O)c(C(=O)Nc2ccc(NC(C)=O)cc2C)cc2ccccc12 |
| InChI | InChI=1S/C34H29N5O5/c1-20-17-25(35-21(2)40)14-15-28(20)37-34(43)27-18-22-9-7-8-12-26(22)31(32(27)41)39-38-29-19-23(13-16-30(29)44-3)33(42)36-24-10-5-4-6-11-24/h4-19,41H,1-3H3,(H,35,40)(H,36,42)(H,37,43)/b39-38+ |
| InChIKey | QCGZHAORVBESFZ-YMZYAJTMSA-N |
| XLogP | 7.74 |
| TPSA | 141.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|