C44H35N5O5 — CID 135843479
3-hydroxy-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl]-2-N-naphthalen-1-yl-7-N-(2-phenylethyl)naphthalene-2,7-dicarboxamide (PubChem CID 135843479) has the molecular formula C44H35N5O5 and a molecular weight of 713.79 g/mol. Its IUPAC name is 3-hydroxy-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl]-2-N-naphthalen-1-yl-7-N-(2-phenylethyl)naphthalene-2,7-dicarboxamide.
| Compound Name | 3-hydroxy-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl]-2-N-naphthalen-1-yl-7-N-(2-phenylethyl)naphthalene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 135843479 |
| Molecular Formula | C44H35N5O5 |
| Molecular Weight | 713.79 g/mol |
| Exact Mass | 713.26 |
| IUPAC Name | 3-hydroxy-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl]-2-N-naphthalen-1-yl-7-N-(2-phenylethyl)naphthalene-2,7-dicarboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2)cc1/N=N/c1c(O)c(C(=O)Nc2cccc3ccccc23)cc2cc(C(=O)NCCc3ccccc3)ccc12 |
| InChI | InChI=1S/C44H35N5O5/c1-54-39-22-20-31(43(52)46-33-15-6-3-7-16-33)27-38(39)48-49-40-35-21-19-30(42(51)45-24-23-28-11-4-2-5-12-28)25-32(35)26-36(41(40)50)44(53)47-37-18-10-14-29-13-8-9-17-34(29)37/h2-22,25-27,50H,23-24H2,1H3,(H,45,51)(H,46,52)(H,47,53)/b49-48+ |
| InChIKey | YSPDIVKVVKUBDO-DSIMXMMZSA-N |
| XLogP | 9.60 |
| TPSA | 141.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.79 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|