C42H32N6O5 — CID 135843478
3-hydroxy-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl]-2-N-naphthalen-1-yl-7-N-(pyridin-3-ylmethyl)naphthalene-2,7-dicarboxamide (PubChem CID 135843478) has the molecular formula C42H32N6O5 and a molecular weight of 700.76 g/mol. Its IUPAC name is 3-hydroxy-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl]-2-N-naphthalen-1-yl-7-N-(pyridin-3-ylmethyl)naphthalene-2,7-dicarboxamide.
| Compound Name | 3-hydroxy-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl]-2-N-naphthalen-1-yl-7-N-(pyridin-3-ylmethyl)naphthalene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 135843478 |
| Molecular Formula | C42H32N6O5 |
| Molecular Weight | 700.76 g/mol |
| Exact Mass | 700.24 |
| IUPAC Name | 3-hydroxy-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl]-2-N-naphthalen-1-yl-7-N-(pyridin-3-ylmethyl)naphthalene-2,7-dicarboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2)cc1/N=N/c1c(O)c(C(=O)Nc2cccc3ccccc23)cc2cc(C(=O)NCc3cccnc3)ccc12 |
| InChI | InChI=1S/C42H32N6O5/c1-53-37-19-17-29(41(51)45-31-12-3-2-4-13-31)23-36(37)47-48-38-33-18-16-28(40(50)44-25-26-9-8-20-43-24-26)21-30(33)22-34(39(38)49)42(52)46-35-15-7-11-27-10-5-6-14-32(27)35/h2-24,49H,25H2,1H3,(H,44,50)(H,45,51)(H,46,52)/b48-47+ |
| InChIKey | POCURBPMYOFMTG-QJGAVIKSSA-N |
| XLogP | 8.95 |
| TPSA | 154.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.76 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|