C45H46N6O5 — CID 135843532
4-[[5-(anilinooxymethyl)-2-methoxyphenyl]diazenyl]-7-N-[3-(cyclohexylamino)propyl]-3-hydroxy-2-N-naphthalen-1-ylnaphthalene-2,7-dicarboxamide (PubChem CID 135843532) has the molecular formula C45H46N6O5 and a molecular weight of 750.90 g/mol. Its IUPAC name is 4-[[5-(anilinooxymethyl)-2-methoxyphenyl]diazenyl]-7-N-[3-(cyclohexylamino)propyl]-3-hydroxy-2-N-naphthalen-1-ylnaphthalene-2,7-dicarboxamide.
| Compound Name | 4-[[5-(anilinooxymethyl)-2-methoxyphenyl]diazenyl]-7-N-[3-(cyclohexylamino)propyl]-3-hydroxy-2-N-naphthalen-1-ylnaphthalene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 135843532 |
| Molecular Formula | C45H46N6O5 |
| Molecular Weight | 750.90 g/mol |
| Exact Mass | 750.35 |
| IUPAC Name | 4-[[5-(anilinooxymethyl)-2-methoxyphenyl]diazenyl]-7-N-[3-(cyclohexylamino)propyl]-3-hydroxy-2-N-naphthalen-1-ylnaphthalene-2,7-dicarboxamide |
| SMILES | COc1ccc(CONc2ccccc2)cc1/N=N/c1c(O)c(C(=O)Nc2cccc3ccccc23)cc2cc(C(=O)NCCCNC3CCCCC3)ccc12 |
| InChI | InChI=1S/C45H46N6O5/c1-55-41-23-20-30(29-56-51-35-16-6-3-7-17-35)26-40(41)49-50-42-37-22-21-32(44(53)47-25-11-24-46-34-14-4-2-5-15-34)27-33(37)28-38(43(42)52)45(54)48-39-19-10-13-31-12-8-9-18-36(31)39/h3,6-10,12-13,16-23,26-28,34,46,51-52H,2,4-5,11,14-15,24-25,29H2,1H3,(H,47,53)(H,48,54)/b50-49+ |
| InChIKey | VWOVGHDCRXVXSK-BNEIJSFPSA-N |
| XLogP | 9.96 |
| TPSA | 145.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.90 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|