C25H19N5O6 — CID 136830288
4-[(5-carbamoyl-2-methoxyphenyl)diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide (PubChem CID 136830288) has the molecular formula C25H19N5O6 and a molecular weight of 485.46 g/mol. Its IUPAC name is 4-[(5-carbamoyl-2-methoxyphenyl)diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide.
| Compound Name | 4-[(5-carbamoyl-2-methoxyphenyl)diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 136830288 |
| Molecular Formula | C25H19N5O6 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 4-[(5-carbamoyl-2-methoxyphenyl)diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide |
| SMILES | COc1ccc(C(N)=O)cc1/N=N/c1c(O)c(C(=O)Nc2cccc([N+](=O)[O-])c2)cc2ccccc12 |
| InChI | InChI=1S/C25H19N5O6/c1-36-21-10-9-15(24(26)32)12-20(21)28-29-22-18-8-3-2-5-14(18)11-19(23(22)31)25(33)27-16-6-4-7-17(13-16)30(34)35/h2-13,31H,1H3,(H2,26,32)(H,27,33)/b29-28+ |
| InChIKey | LHTBIXQCGQPUIR-ZQHSETAFSA-N |
| XLogP | 5.23 |
| TPSA | 169.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|