C30H23N5O9S2 — CID 136863286
3-[[3-[[2-hydroxy-3-[(3-nitrophenyl)carbamoyl]naphthalen-1-yl]diazenyl]-4-methylphenyl]sulfonylamino]benzenesulfonic acid (PubChem CID 136863286) has the molecular formula C30H23N5O9S2 and a molecular weight of 661.67 g/mol. Its IUPAC name is 3-[[3-[[2-hydroxy-3-[(3-nitrophenyl)carbamoyl]naphthalen-1-yl]diazenyl]-4-methylphenyl]sulfonylamino]benzenesulfonic acid.
| Compound Name | 3-[[3-[[2-hydroxy-3-[(3-nitrophenyl)carbamoyl]naphthalen-1-yl]diazenyl]-4-methylphenyl]sulfonylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 136863286 |
| Molecular Formula | C30H23N5O9S2 |
| Molecular Weight | 661.67 g/mol |
| Exact Mass | 661.09 |
| IUPAC Name | 3-[[3-[[2-hydroxy-3-[(3-nitrophenyl)carbamoyl]naphthalen-1-yl]diazenyl]-4-methylphenyl]sulfonylamino]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(S(=O)(=O)O)c2)cc1/N=N/c1c(O)c(C(=O)Nc2cccc([N+](=O)[O-])c2)cc2ccccc12 |
| InChI | InChI=1S/C30H23N5O9S2/c1-18-12-13-23(45(40,41)34-21-8-5-10-24(16-21)46(42,43)44)17-27(18)32-33-28-25-11-3-2-6-19(25)14-26(29(28)36)30(37)31-20-7-4-9-22(15-20)35(38)39/h2-17,34,36H,1H3,(H,31,37)(H,42,43,44)/b33-32+ |
| InChIKey | OOAMCSWRMQESMQ-ULIFNZDWSA-N |
| XLogP | 6.48 |
| TPSA | 217.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|