C27H23N5O6 — CID 137293468
4-[[2-(dimethylcarbamoyl)-6-methoxyphenyl]diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide (PubChem CID 137293468) has the molecular formula C27H23N5O6 and a molecular weight of 513.51 g/mol. Its IUPAC name is 4-[[2-(dimethylcarbamoyl)-6-methoxyphenyl]diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide.
| Compound Name | 4-[[2-(dimethylcarbamoyl)-6-methoxyphenyl]diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 137293468 |
| Molecular Formula | C27H23N5O6 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 4-[[2-(dimethylcarbamoyl)-6-methoxyphenyl]diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide |
| SMILES | COc1cccc(C(=O)N(C)C)c1/N=N/c1c(O)c(C(=O)Nc2cccc([N+](=O)[O-])c2)cc2ccccc12 |
| InChI | InChI=1S/C27H23N5O6/c1-31(2)27(35)20-12-7-13-22(38-3)23(20)29-30-24-19-11-5-4-8-16(19)14-21(25(24)33)26(34)28-17-9-6-10-18(15-17)32(36)37/h4-15,33H,1-3H3,(H,28,34)/b30-29+ |
| InChIKey | NCLLPKFBKUOEJJ-QVIHXGFCSA-N |
| XLogP | 5.83 |
| TPSA | 146.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|