C26H23N5O7S — CID 137304864
4-[[5-(dimethylsulfamoyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide (PubChem CID 137304864) has the molecular formula C26H23N5O7S and a molecular weight of 549.57 g/mol. Its IUPAC name is 4-[[5-(dimethylsulfamoyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide.
| Compound Name | 4-[[5-(dimethylsulfamoyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 137304864 |
| Molecular Formula | C26H23N5O7S |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 4-[[5-(dimethylsulfamoyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)C)cc1/N=N/c1c(O)c(C(=O)Nc2cccc([N+](=O)[O-])c2)cc2ccccc12 |
| InChI | InChI=1S/C26H23N5O7S/c1-30(2)39(36,37)19-11-12-23(38-3)22(15-19)28-29-24-20-10-5-4-7-16(20)13-21(25(24)32)26(33)27-17-8-6-9-18(14-17)31(34)35/h4-15,32H,1-3H3,(H,27,33)/b29-28+ |
| InChIKey | IKGUQIAFCFWRFN-ZQHSETAFSA-N |
| XLogP | 5.38 |
| TPSA | 163.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|