C28H27N3O8S — CID 3018846
N-(2,5-dimethoxyphenyl)-3-hydroxy-4-[[5-(2-hydroxyethylsulfonyl)-2-methoxyphenyl]diazenyl]naphthalene-2-carboxamide (PubChem CID 3018846) has the molecular formula C28H27N3O8S and a molecular weight of 565.60 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-3-hydroxy-4-[[5-(2-hydroxyethylsulfonyl)-2-methoxyphenyl]diazenyl]naphthalene-2-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-3-hydroxy-4-[[5-(2-hydroxyethylsulfonyl)-2-methoxyphenyl]diazenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3018846 |
| Molecular Formula | C28H27N3O8S |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-3-hydroxy-4-[[5-(2-hydroxyethylsulfonyl)-2-methoxyphenyl]diazenyl]naphthalene-2-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cc3ccccc3c(/N=N/c3cc(S(=O)(=O)CCO)ccc3OC)c2O)c1 |
| InChI | InChI=1S/C28H27N3O8S/c1-37-18-8-10-24(38-2)22(15-18)29-28(34)21-14-17-6-4-5-7-20(17)26(27(21)33)31-30-23-16-19(9-11-25(23)39-3)40(35,36)13-12-32/h4-11,14-16,32-33H,12-13H2,1-3H3,(H,29,34)/b31-30+ |
| InChIKey | GQGXSIQPECXJTG-NVQSTNCTSA-N |
| XLogP | 5.00 |
| TPSA | 156.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|