C29H31N5O16S4 — CID 135730728
2-[[3-[[2-hydroxy-3-[[2-methoxy-5-(2-sulfooxyethylsulfamoyl)phenyl]carbamoyl]naphthalen-1-yl]diazenyl]-4-methoxyphenyl]sulfonylamino]ethyl hydrogen sulfate (PubChem CID 135730728) has the molecular formula C29H31N5O16S4 and a molecular weight of 833.85 g/mol. Its IUPAC name is 2-[[3-[[2-hydroxy-3-[[2-methoxy-5-(2-sulfooxyethylsulfamoyl)phenyl]carbamoyl]naphthalen-1-yl]diazenyl]-4-methoxyphenyl]sulfonylamino]ethyl hydrogen sulfate.
| Compound Name | 2-[[3-[[2-hydroxy-3-[[2-methoxy-5-(2-sulfooxyethylsulfamoyl)phenyl]carbamoyl]naphthalen-1-yl]diazenyl]-4-methoxyphenyl]sulfonylamino]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 135730728 |
| Molecular Formula | C29H31N5O16S4 |
| Molecular Weight | 833.85 g/mol |
| Exact Mass | 833.06 |
| IUPAC Name | 2-[[3-[[2-hydroxy-3-[[2-methoxy-5-(2-sulfooxyethylsulfamoyl)phenyl]carbamoyl]naphthalen-1-yl]diazenyl]-4-methoxyphenyl]sulfonylamino]ethyl hydrogen sulfate |
| SMILES | COc1ccc(S(=O)(=O)NCCOS(=O)(=O)O)cc1/N=N/c1c(O)c(C(=O)Nc2cc(S(=O)(=O)NCCOS(=O)(=O)O)ccc2OC)cc2ccccc12 |
| InChI | InChI=1S/C29H31N5O16S4/c1-47-25-9-7-19(51(37,38)30-11-13-49-53(41,42)43)16-23(25)32-29(36)22-15-18-5-3-4-6-21(18)27(28(22)35)34-33-24-17-20(8-10-26(24)48-2)52(39,40)31-12-14-50-54(44,45)46/h3-10,15-17,30-31,35H,11-14H2,1-2H3,(H,32,36)(H,41,42,43)(H,44,45,46)/b34-33+ |
| InChIKey | APCSCNGBTPPSTB-JEIPZWNWSA-N |
| XLogP | 2.43 |
| TPSA | 312.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.85 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|