C36H31N5O4 — CID 135843504
4-[[5-(anilinooxymethyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-7-methyl-N-(2-methylquinolin-4-yl)naphthalene-2-carboxamide (PubChem CID 135843504) has the molecular formula C36H31N5O4 and a molecular weight of 597.68 g/mol. Its IUPAC name is 4-[[5-(anilinooxymethyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-7-methyl-N-(2-methylquinolin-4-yl)naphthalene-2-carboxamide.
| Compound Name | 4-[[5-(anilinooxymethyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-7-methyl-N-(2-methylquinolin-4-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 135843504 |
| Molecular Formula | C36H31N5O4 |
| Molecular Weight | 597.68 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | 4-[[5-(anilinooxymethyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-7-methyl-N-(2-methylquinolin-4-yl)naphthalene-2-carboxamide |
| SMILES | COc1ccc(CONc2ccccc2)cc1/N=N/c1c(O)c(C(=O)Nc2cc(C)nc3ccccc23)cc2cc(C)ccc12 |
| InChI | InChI=1S/C36H31N5O4/c1-22-13-15-27-25(17-22)20-29(36(43)38-31-18-23(2)37-30-12-8-7-11-28(30)31)35(42)34(27)40-39-32-19-24(14-16-33(32)44-3)21-45-41-26-9-5-4-6-10-26/h4-20,41-42H,21H2,1-3H3,(H,37,38,43)/b40-39+ |
| InChIKey | KPVODIJOLDCRSY-XQQUEIPISA-N |
| XLogP | 8.93 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.68 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|