C27H21ClF3N3O4 — CID 135843549
N-(5-chloro-2,4-dimethoxyphenyl)-3-hydroxy-7-methyl-4-[[2-(trifluoromethyl)phenyl]diazenyl]naphthalene-2-carboxamide (PubChem CID 135843549) has the molecular formula C27H21ClF3N3O4 and a molecular weight of 543.93 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-3-hydroxy-7-methyl-4-[[2-(trifluoromethyl)phenyl]diazenyl]naphthalene-2-carboxamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-3-hydroxy-7-methyl-4-[[2-(trifluoromethyl)phenyl]diazenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 135843549 |
| Molecular Formula | C27H21ClF3N3O4 |
| Molecular Weight | 543.93 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-3-hydroxy-7-methyl-4-[[2-(trifluoromethyl)phenyl]diazenyl]naphthalene-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2cc3cc(C)ccc3c(/N=N/c3ccccc3C(F)(F)F)c2O)cc1Cl |
| InChI | InChI=1S/C27H21ClF3N3O4/c1-14-8-9-16-15(10-14)11-17(26(36)32-21-12-19(28)22(37-2)13-23(21)38-3)25(35)24(16)34-33-20-7-5-4-6-18(20)27(29,30)31/h4-13,35H,1-3H3,(H,32,36)/b34-33+ |
| InChIKey | IWCDINZOVTZKOJ-JEIPZWNWSA-N |
| XLogP | 8.21 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.93 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|