C25H21N3O2 — CID 3798515
N-(2,4-dimethylphenyl)-3-hydroxy-4-phenyldiazenylnaphthalene-2-carboxamide (PubChem CID 3798515) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-hydroxy-4-phenyldiazenylnaphthalene-2-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-hydroxy-4-phenyldiazenylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3798515 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-hydroxy-4-phenyldiazenylnaphthalene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc3ccccc3c(/N=N/c3ccccc3)c2O)c(C)c1 |
| InChI | InChI=1S/C25H21N3O2/c1-16-12-13-22(17(2)14-16)26-25(30)21-15-18-8-6-7-11-20(18)23(24(21)29)28-27-19-9-4-3-5-10-19/h3-15,29H,1-2H3,(H,26,30)/b28-27+ |
| InChIKey | RZCANHITBQHSHB-BYYHNAKLSA-N |
| XLogP | 6.83 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|