C25H21N5O3 — CID 162195447
3-hydroxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-phenyldiazenylnaphthalene-2-carboxamide;methane (PubChem CID 162195447) has the molecular formula C25H21N5O3 and a molecular weight of 439.48 g/mol. Its IUPAC name is 3-hydroxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-phenyldiazenylnaphthalene-2-carboxamide;methane.
| Compound Name | 3-hydroxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-phenyldiazenylnaphthalene-2-carboxamide;methane |
|---|---|
| PubChem CID | 162195447 |
| Molecular Formula | C25H21N5O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 3-hydroxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-phenyldiazenylnaphthalene-2-carboxamide;methane |
| SMILES | C.O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc2ccccc2c(/N=N/c2ccccc2)c1O |
| InChI | InChI=1S/C24H17N5O3.CH4/c30-22-18(23(31)25-16-10-11-19-20(13-16)27-24(32)26-19)12-14-6-4-5-9-17(14)21(22)29-28-15-7-2-1-3-8-15;/h1-13,30H,(H,25,31)(H2,26,27,32);1H4/b29-28+; |
| InChIKey | ZQWINNUFGFNPEO-IRWWKPKRSA-N |
| XLogP | 6.02 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|