C48H32N6O5 — CID 135731626
3-hydroxy-4-[[7-[[2-hydroxy-3-[(3-methylphenyl)carbamoyl]naphthalen-1-yl]diazenyl]-9-oxofluoren-2-yl]diazenyl]-N-phenylnaphthalene-2-carboxamide (PubChem CID 135731626) has the molecular formula C48H32N6O5 and a molecular weight of 772.82 g/mol. Its IUPAC name is 3-hydroxy-4-[[7-[[2-hydroxy-3-[(3-methylphenyl)carbamoyl]naphthalen-1-yl]diazenyl]-9-oxofluoren-2-yl]diazenyl]-N-phenylnaphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-4-[[7-[[2-hydroxy-3-[(3-methylphenyl)carbamoyl]naphthalen-1-yl]diazenyl]-9-oxofluoren-2-yl]diazenyl]-N-phenylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 135731626 |
| Molecular Formula | C48H32N6O5 |
| Molecular Weight | 772.82 g/mol |
| Exact Mass | 772.24 |
| IUPAC Name | 3-hydroxy-4-[[7-[[2-hydroxy-3-[(3-methylphenyl)carbamoyl]naphthalen-1-yl]diazenyl]-9-oxofluoren-2-yl]diazenyl]-N-phenylnaphthalene-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc3ccccc3c(/N=N/c3ccc4c(c3)C(=O)c3cc(/N=N/c5c(O)c(C(=O)Nc6ccccc6)cc6ccccc56)ccc3-4)c2O)c1 |
| InChI | InChI=1S/C48H32N6O5/c1-27-10-9-15-31(22-27)50-48(59)41-24-29-12-6-8-17-35(29)43(46(41)57)54-52-33-19-21-37-36-20-18-32(25-38(36)44(55)39(37)26-33)51-53-42-34-16-7-5-11-28(34)23-40(45(42)56)47(58)49-30-13-3-2-4-14-30/h2-26,56-57H,1H3,(H,49,58)(H,50,59)/b53-51+,54-52+ |
| InChIKey | JDTHYVJAXAQUBG-NQOGYPPHSA-N |
| XLogP | 12.26 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.82 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|