C48H31ClN6O6 — CID 135731631
4-[[7-[[3-[(2-chlorophenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-9-oxofluoren-2-yl]diazenyl]-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide (PubChem CID 135731631) has the molecular formula C48H31ClN6O6 and a molecular weight of 823.27 g/mol. Its IUPAC name is 4-[[7-[[3-[(2-chlorophenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-9-oxofluoren-2-yl]diazenyl]-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide.
| Compound Name | 4-[[7-[[3-[(2-chlorophenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-9-oxofluoren-2-yl]diazenyl]-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 135731631 |
| Molecular Formula | C48H31ClN6O6 |
| Molecular Weight | 823.27 g/mol |
| Exact Mass | 822.20 |
| IUPAC Name | 4-[[7-[[3-[(2-chlorophenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-9-oxofluoren-2-yl]diazenyl]-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1cc2ccccc2c(/N=N/c2ccc3c(c2)C(=O)c2cc(/N=N/c4c(O)c(C(=O)Nc5ccccc5Cl)cc5ccccc45)ccc2-3)c1O |
| InChI | InChI=1S/C48H31ClN6O6/c1-61-41-17-9-8-16-40(41)51-48(60)37-23-27-11-3-5-13-31(27)43(46(37)58)55-53-29-19-21-33-32-20-18-28(24-34(32)44(56)35(33)25-29)52-54-42-30-12-4-2-10-26(30)22-36(45(42)57)47(59)50-39-15-7-6-14-38(39)49/h2-25,57-58H,1H3,(H,50,59)(H,51,60)/b54-52+,55-53+ |
| InChIKey | IENFJMOQFXPDFA-UTTFBYFCSA-N |
| XLogP | 12.61 |
| TPSA | 174.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.27 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|