C48H30N6O6 — CID 135731638
4-[[7-[[3-[(3-formylphenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-9-oxofluoren-2-yl]diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide (PubChem CID 135731638) has the molecular formula C48H30N6O6 and a molecular weight of 786.80 g/mol. Its IUPAC name is 4-[[7-[[3-[(3-formylphenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-9-oxofluoren-2-yl]diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide.
| Compound Name | 4-[[7-[[3-[(3-formylphenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-9-oxofluoren-2-yl]diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 135731638 |
| Molecular Formula | C48H30N6O6 |
| Molecular Weight | 786.80 g/mol |
| Exact Mass | 786.22 |
| IUPAC Name | 4-[[7-[[3-[(3-formylphenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-9-oxofluoren-2-yl]diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
| SMILES | O=Cc1cccc(NC(=O)c2cc3ccccc3c(/N=N/c3ccc4c(c3)C(=O)c3cc(/N=N/c5c(O)c(C(=O)Nc6ccccc6)cc6ccccc56)ccc3-4)c2O)c1 |
| InChI | InChI=1S/C48H30N6O6/c55-26-27-9-8-14-31(21-27)50-48(60)41-23-29-11-5-7-16-35(29)43(46(41)58)54-52-33-18-20-37-36-19-17-32(24-38(36)44(56)39(37)25-33)51-53-42-34-15-6-4-10-28(34)22-40(45(42)57)47(59)49-30-12-2-1-3-13-30/h1-26,57-58H,(H,49,59)(H,50,60)/b53-51+,54-52+ |
| InChIKey | RMWWRQBSUYPNLM-NQOGYPPHSA-N |
| XLogP | 11.76 |
| TPSA | 182.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.80 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|