C24H19N3O2 — CID 137389574
3-methoxy-N-phenyl-4-phenyldiazenylnaphthalene-2-carboxamide (PubChem CID 137389574) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 3-methoxy-N-phenyl-4-phenyldiazenylnaphthalene-2-carboxamide.
| Compound Name | 3-methoxy-N-phenyl-4-phenyldiazenylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 137389574 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-methoxy-N-phenyl-4-phenyldiazenylnaphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)Nc2ccccc2)cc2ccccc2c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C24H19N3O2/c1-29-23-21(24(28)25-18-11-4-2-5-12-18)16-17-10-8-9-15-20(17)22(23)27-26-19-13-6-3-7-14-19/h2-16H,1H3,(H,25,28)/b27-26+ |
| InChIKey | CHSSNKANSYWLFE-CYYJNZCTSA-N |
| XLogP | 6.52 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|