C29H29ClN4O2 — CID 136620067
4-[[4-(3-aminopentan-3-yl)phenyl]diazenyl]-N-(5-chloro-2-methylphenyl)-3-hydroxynaphthalene-2-carboxamide (PubChem CID 136620067) has the molecular formula C29H29ClN4O2 and a molecular weight of 501.03 g/mol. Its IUPAC name is 4-[[4-(3-aminopentan-3-yl)phenyl]diazenyl]-N-(5-chloro-2-methylphenyl)-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | 4-[[4-(3-aminopentan-3-yl)phenyl]diazenyl]-N-(5-chloro-2-methylphenyl)-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 136620067 |
| Molecular Formula | C29H29ClN4O2 |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 4-[[4-(3-aminopentan-3-yl)phenyl]diazenyl]-N-(5-chloro-2-methylphenyl)-3-hydroxynaphthalene-2-carboxamide |
| SMILES | CCC(N)(CC)c1ccc(/N=N/c2c(O)c(C(=O)Nc3cc(Cl)ccc3C)cc3ccccc23)cc1 |
| InChI | InChI=1S/C29H29ClN4O2/c1-4-29(31,5-2)20-11-14-22(15-12-20)33-34-26-23-9-7-6-8-19(23)16-24(27(26)35)28(36)32-25-17-21(30)13-10-18(25)3/h6-17,35H,4-5,31H2,1-3H3,(H,32,36)/b34-33+ |
| InChIKey | BUABTJRKYKFSIG-JEIPZWNWSA-N |
| XLogP | 8.15 |
| TPSA | 100.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|