C26H21Cl2N3O6S — CID 136855337
2-chloro-4-[[3-[(3-chloro-2-ethoxyphenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-6-methylbenzenesulfonic acid (PubChem CID 136855337) has the molecular formula C26H21Cl2N3O6S and a molecular weight of 574.44 g/mol. Its IUPAC name is 2-chloro-4-[[3-[(3-chloro-2-ethoxyphenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-6-methylbenzenesulfonic acid.
| Compound Name | 2-chloro-4-[[3-[(3-chloro-2-ethoxyphenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-6-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 136855337 |
| Molecular Formula | C26H21Cl2N3O6S |
| Molecular Weight | 574.44 g/mol |
| Exact Mass | 573.05 |
| IUPAC Name | 2-chloro-4-[[3-[(3-chloro-2-ethoxyphenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-6-methylbenzenesulfonic acid |
| SMILES | CCOc1c(Cl)cccc1NC(=O)c1cc2ccccc2c(/N=N/c2cc(C)c(S(=O)(=O)O)c(Cl)c2)c1O |
| InChI | InChI=1S/C26H21Cl2N3O6S/c1-3-37-24-19(27)9-6-10-21(24)29-26(33)18-12-15-7-4-5-8-17(15)22(23(18)32)31-30-16-11-14(2)25(20(28)13-16)38(34,35)36/h4-13,32H,3H2,1-2H3,(H,29,33)(H,34,35,36)/b31-30+ |
| InChIKey | TUHBAFVRWHVHDD-NVQSTNCTSA-N |
| XLogP | 7.47 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.44 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|