C27H23Cl2N3O6S — CID 136856333
2-chloro-4-[[3-[(2-chloro-4-ethoxyphenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-6-ethylbenzenesulfonic acid (PubChem CID 136856333) has the molecular formula C27H23Cl2N3O6S and a molecular weight of 588.47 g/mol. Its IUPAC name is 2-chloro-4-[[3-[(2-chloro-4-ethoxyphenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-6-ethylbenzenesulfonic acid.
| Compound Name | 2-chloro-4-[[3-[(2-chloro-4-ethoxyphenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-6-ethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 136856333 |
| Molecular Formula | C27H23Cl2N3O6S |
| Molecular Weight | 588.47 g/mol |
| Exact Mass | 587.07 |
| IUPAC Name | 2-chloro-4-[[3-[(2-chloro-4-ethoxyphenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-6-ethylbenzenesulfonic acid |
| SMILES | CCOc1ccc(NC(=O)c2cc3ccccc3c(/N=N/c3cc(Cl)c(S(=O)(=O)O)c(CC)c3)c2O)c(Cl)c1 |
| InChI | InChI=1S/C27H23Cl2N3O6S/c1-3-15-11-17(13-22(29)26(15)39(35,36)37)31-32-24-19-8-6-5-7-16(19)12-20(25(24)33)27(34)30-23-10-9-18(38-4-2)14-21(23)28/h5-14,33H,3-4H2,1-2H3,(H,30,34)(H,35,36,37)/b32-31+ |
| InChIKey | YMRFBTDYWUKOEB-QNEJGDQOSA-N |
| XLogP | 7.73 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.47 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|