C25H23Cl2N3O2 — CID 145160136
4-amino-N-(5-chloro-2-methylphenyl)-3-hydroxynaphthalene-2-carboxamide;5-chloro-2-methylaniline (PubChem CID 145160136) has the molecular formula C25H23Cl2N3O2 and a molecular weight of 468.38 g/mol. Its IUPAC name is 4-amino-N-(5-chloro-2-methylphenyl)-3-hydroxynaphthalene-2-carboxamide;5-chloro-2-methylaniline.
| Compound Name | 4-amino-N-(5-chloro-2-methylphenyl)-3-hydroxynaphthalene-2-carboxamide;5-chloro-2-methylaniline |
|---|---|
| PubChem CID | 145160136 |
| Molecular Formula | C25H23Cl2N3O2 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 4-amino-N-(5-chloro-2-methylphenyl)-3-hydroxynaphthalene-2-carboxamide;5-chloro-2-methylaniline |
| SMILES | Cc1ccc(Cl)cc1N.Cc1ccc(Cl)cc1NC(=O)c1cc2ccccc2c(N)c1O |
| InChI | InChI=1S/C18H15ClN2O2.C7H8ClN/c1-10-6-7-12(19)9-15(10)21-18(23)14-8-11-4-2-3-5-13(11)16(20)17(14)22;1-5-2-3-6(8)4-7(5)9/h2-9,22H,20H2,1H3,(H,21,23);2-4H,9H2,1H3 |
| InChIKey | CKEIWDKKBWQKBD-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_OH_no_alk_B(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|