C26H26N4O4 — CID 145216667
4-amino-3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide;3-amino-4-methoxybenzamide (PubChem CID 145216667) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 4-amino-3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide;3-amino-4-methoxybenzamide.
| Compound Name | 4-amino-3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide;3-amino-4-methoxybenzamide |
|---|---|
| PubChem CID | 145216667 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 4-amino-3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide;3-amino-4-methoxybenzamide |
| SMILES | COc1ccc(C(N)=O)cc1N.Cc1ccccc1NC(=O)c1cc2ccccc2c(N)c1O |
| InChI | InChI=1S/C18H16N2O2.C8H10N2O2/c1-11-6-2-5-9-15(11)20-18(22)14-10-12-7-3-4-8-13(12)16(19)17(14)21;1-12-7-3-2-5(8(10)11)4-6(7)9/h2-10,21H,19H2,1H3,(H,20,22);2-4H,9H2,1H3,(H2,10,11) |
| InChIKey | RXNWUILBNSWWHS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 153.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OH_no_alk_B(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|