C30H28N4O4 — CID 145216655
4-amino-3-hydroxy-N-naphthalen-1-ylnaphthalene-2-carboxamide;3-amino-4-methoxy-N-methylbenzamide (PubChem CID 145216655) has the molecular formula C30H28N4O4 and a molecular weight of 508.58 g/mol. Its IUPAC name is 4-amino-3-hydroxy-N-naphthalen-1-ylnaphthalene-2-carboxamide;3-amino-4-methoxy-N-methylbenzamide.
| Compound Name | 4-amino-3-hydroxy-N-naphthalen-1-ylnaphthalene-2-carboxamide;3-amino-4-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 145216655 |
| Molecular Formula | C30H28N4O4 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 4-amino-3-hydroxy-N-naphthalen-1-ylnaphthalene-2-carboxamide;3-amino-4-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(OC)c(N)c1.Nc1c(O)c(C(=O)Nc2cccc3ccccc23)cc2ccccc12 |
| InChI | InChI=1S/C21H16N2O2.C9H12N2O2/c22-19-16-10-4-2-7-14(16)12-17(20(19)24)21(25)23-18-11-5-8-13-6-1-3-9-15(13)18;1-11-9(12)6-3-4-8(13-2)7(10)5-6/h1-12,24H,22H2,(H,23,25);3-5H,10H2,1-2H3,(H,11,12) |
| InChIKey | RGNONGYUIZISHU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OH_no_alk_B(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|