C16H18N2O2 — CID 16792404
3-amino-N-(2,3-dimethylphenyl)-4-methoxybenzamide (PubChem CID 16792404) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-amino-N-(2,3-dimethylphenyl)-4-methoxybenzamide.
| Compound Name | 3-amino-N-(2,3-dimethylphenyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 16792404 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3-amino-N-(2,3-dimethylphenyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(C)c2C)cc1N |
| InChI | InChI=1S/C16H18N2O2/c1-10-5-4-6-14(11(10)2)18-16(19)12-7-8-15(20-3)13(17)9-12/h4-9H,17H2,1-3H3,(H,18,19) |
| InChIKey | HLFTYWIXSUINIO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|