C19H23NO3 — CID 2599686
N-(2,3-dimethylphenyl)-3-methoxy-4-propoxybenzamide (PubChem CID 2599686) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-3-methoxy-4-propoxybenzamide.
| Compound Name | N-(2,3-dimethylphenyl)-3-methoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 2599686 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-(2,3-dimethylphenyl)-3-methoxy-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)Nc2cccc(C)c2C)cc1OC |
| InChI | InChI=1S/C19H23NO3/c1-5-11-23-17-10-9-15(12-18(17)22-4)19(21)20-16-8-6-7-13(2)14(16)3/h6-10,12H,5,11H2,1-4H3,(H,20,21) |
| InChIKey | KVKLZFZRHXEVTI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |