C25H27N3O6S — CID 24553526
4-[[(3-methoxy-4-propoxybenzoyl)amino]carbamoyl]-N-(2-methylphenyl)benzenesulfonamide (PubChem CID 24553526) has the molecular formula C25H27N3O6S and a molecular weight of 497.57 g/mol. Its IUPAC name is 4-[[(3-methoxy-4-propoxybenzoyl)amino]carbamoyl]-N-(2-methylphenyl)benzenesulfonamide.
| Compound Name | 4-[[(3-methoxy-4-propoxybenzoyl)amino]carbamoyl]-N-(2-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 24553526 |
| Molecular Formula | C25H27N3O6S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 4-[[(3-methoxy-4-propoxybenzoyl)amino]carbamoyl]-N-(2-methylphenyl)benzenesulfonamide |
| SMILES | CCCOc1ccc(C(=O)NNC(=O)c2ccc(S(=O)(=O)Nc3ccccc3C)cc2)cc1OC |
| InChI | InChI=1S/C25H27N3O6S/c1-4-15-34-22-14-11-19(16-23(22)33-3)25(30)27-26-24(29)18-9-12-20(13-10-18)35(31,32)28-21-8-6-5-7-17(21)2/h5-14,16,28H,4,15H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | SBDHFUNRKFLDHT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|