C22H28N2O6S — CID 46490716
4-butoxy-3-methoxy-N'-(4-propan-2-ylsulfonylbenzoyl)benzohydrazide (PubChem CID 46490716) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is 4-butoxy-3-methoxy-N'-(4-propan-2-ylsulfonylbenzoyl)benzohydrazide.
| Compound Name | 4-butoxy-3-methoxy-N'-(4-propan-2-ylsulfonylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 46490716 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 4-butoxy-3-methoxy-N'-(4-propan-2-ylsulfonylbenzoyl)benzohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)c2ccc(S(=O)(=O)C(C)C)cc2)cc1OC |
| InChI | InChI=1S/C22H28N2O6S/c1-5-6-13-30-19-12-9-17(14-20(19)29-4)22(26)24-23-21(25)16-7-10-18(11-8-16)31(27,28)15(2)3/h7-12,14-15H,5-6,13H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | DENJFAWQJJOLGQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|