C28H25Cl2N3O7 — CID 143054180
4-amino-2-N,7-N-bis(4-chloro-2,5-dimethoxyphenyl)-3-hydroxynaphthalene-2,7-dicarboxamide (PubChem CID 143054180) has the molecular formula C28H25Cl2N3O7 and a molecular weight of 586.43 g/mol. Its IUPAC name is 4-amino-2-N,7-N-bis(4-chloro-2,5-dimethoxyphenyl)-3-hydroxynaphthalene-2,7-dicarboxamide.
| Compound Name | 4-amino-2-N,7-N-bis(4-chloro-2,5-dimethoxyphenyl)-3-hydroxynaphthalene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 143054180 |
| Molecular Formula | C28H25Cl2N3O7 |
| Molecular Weight | 586.43 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | 4-amino-2-N,7-N-bis(4-chloro-2,5-dimethoxyphenyl)-3-hydroxynaphthalene-2,7-dicarboxamide |
| SMILES | COc1cc(NC(=O)c2ccc3c(N)c(O)c(C(=O)Nc4cc(OC)c(Cl)cc4OC)cc3c2)c(OC)cc1Cl |
| InChI | InChI=1S/C28H25Cl2N3O7/c1-37-21-11-19(23(39-3)9-17(21)29)32-27(35)13-5-6-15-14(7-13)8-16(26(34)25(15)31)28(36)33-20-12-22(38-2)18(30)10-24(20)40-4/h5-12,34H,31H2,1-4H3,(H,32,35)(H,33,36) |
| InChIKey | WOSPHZTYKHEVJV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.43 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|