C20H20N2O2 — CID 94760233
3-(3-amino-4-methoxyphenyl)-N-naphthalen-1-ylpropanamide (PubChem CID 94760233) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-(3-amino-4-methoxyphenyl)-N-naphthalen-1-ylpropanamide.
| Compound Name | 3-(3-amino-4-methoxyphenyl)-N-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 94760233 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3-(3-amino-4-methoxyphenyl)-N-naphthalen-1-ylpropanamide |
| SMILES | COc1ccc(CCC(=O)Nc2cccc3ccccc23)cc1N |
| InChI | InChI=1S/C20H20N2O2/c1-24-19-11-9-14(13-17(19)21)10-12-20(23)22-18-8-4-6-15-5-2-3-7-16(15)18/h2-9,11,13H,10,12,21H2,1H3,(H,22,23) |
| InChIKey | UBSOALJNDKUABN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|