C20H19NO3 — CID 78804407
2-(2,5-dimethoxyphenyl)-N-naphthalen-1-ylacetamide (PubChem CID 78804407) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-N-naphthalen-1-ylacetamide.
| Compound Name | 2-(2,5-dimethoxyphenyl)-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 78804407 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-N-naphthalen-1-ylacetamide |
| SMILES | COc1ccc(OC)c(CC(=O)Nc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C20H19NO3/c1-23-16-10-11-19(24-2)15(12-16)13-20(22)21-18-9-5-7-14-6-3-4-8-17(14)18/h3-12H,13H2,1-2H3,(H,21,22) |
| InChIKey | BGEXTGPUCSEICZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |