C19H21NO5 — CID 16557440
2-(5-acetyl-2-methoxyphenyl)-N-(2,5-dimethoxyphenyl)acetamide (PubChem CID 16557440) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-(5-acetyl-2-methoxyphenyl)-N-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-(5-acetyl-2-methoxyphenyl)-N-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16557440 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-(5-acetyl-2-methoxyphenyl)-N-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)Cc2cc(C(C)=O)ccc2OC)c1 |
| InChI | InChI=1S/C19H21NO5/c1-12(21)13-5-7-17(24-3)14(9-13)10-19(22)20-16-11-15(23-2)6-8-18(16)25-4/h5-9,11H,10H2,1-4H3,(H,20,22) |
| InChIKey | REQXGVQYXSADQO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |