C17H15Cl2NO3 — CID 30845420
2-(5-acetyl-2-methoxyphenyl)-N-(2,5-dichlorophenyl)acetamide (PubChem CID 30845420) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is 2-(5-acetyl-2-methoxyphenyl)-N-(2,5-dichlorophenyl)acetamide.
| Compound Name | 2-(5-acetyl-2-methoxyphenyl)-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 30845420 |
| Molecular Formula | C17H15Cl2NO3 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-(5-acetyl-2-methoxyphenyl)-N-(2,5-dichlorophenyl)acetamide |
| SMILES | COc1ccc(C(C)=O)cc1CC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H15Cl2NO3/c1-10(21)11-3-6-16(23-2)12(7-11)8-17(22)20-15-9-13(18)4-5-14(15)19/h3-7,9H,8H2,1-2H3,(H,20,22) |
| InChIKey | MZNTYGFBPGGPQL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |