C35H33N5O2 — CID 136620032
1-[[4-(3-aminopentan-3-yl)phenyl]diazenyl]-2-hydroxy-N-(2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide (PubChem CID 136620032) has the molecular formula C35H33N5O2 and a molecular weight of 555.68 g/mol. Its IUPAC name is 1-[[4-(3-aminopentan-3-yl)phenyl]diazenyl]-2-hydroxy-N-(2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide.
| Compound Name | 1-[[4-(3-aminopentan-3-yl)phenyl]diazenyl]-2-hydroxy-N-(2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide |
|---|---|
| PubChem CID | 136620032 |
| Molecular Formula | C35H33N5O2 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 1-[[4-(3-aminopentan-3-yl)phenyl]diazenyl]-2-hydroxy-N-(2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide |
| SMILES | CCC(N)(CC)c1ccc(/N=N/c2c(O)c(C(=O)Nc3ccccc3C)cc3ccc4c5ccccc5[nH]c4c23)cc1 |
| InChI | InChI=1S/C35H33N5O2/c1-4-35(36,5-2)23-15-17-24(18-16-23)39-40-32-30-22(14-19-26-25-11-7-9-13-29(25)37-31(26)30)20-27(33(32)41)34(42)38-28-12-8-6-10-21(28)3/h6-20,37,41H,4-5,36H2,1-3H3,(H,38,42)/b40-39+ |
| InChIKey | MOXABDRRBFLWQT-XQQUEIPISA-N |
| XLogP | 9.13 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|