C34H35N5O2 — CID 136618865
ethane;3-[(2-ethylanilino)oxymethyl]-1-[[4-(methylamino)phenyl]diazenyl]-11H-benzo[a]carbazol-2-ol (PubChem CID 136618865) has the molecular formula C34H35N5O2 and a molecular weight of 545.69 g/mol. Its IUPAC name is ethane;3-[(2-ethylanilino)oxymethyl]-1-[[4-(methylamino)phenyl]diazenyl]-11H-benzo[a]carbazol-2-ol.
| Compound Name | ethane;3-[(2-ethylanilino)oxymethyl]-1-[[4-(methylamino)phenyl]diazenyl]-11H-benzo[a]carbazol-2-ol |
|---|---|
| PubChem CID | 136618865 |
| Molecular Formula | C34H35N5O2 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | ethane;3-[(2-ethylanilino)oxymethyl]-1-[[4-(methylamino)phenyl]diazenyl]-11H-benzo[a]carbazol-2-ol |
| SMILES | CC.CCc1ccccc1NOCc1cc2ccc3c4ccccc4[nH]c3c2c(/N=N/c2ccc(NC)cc2)c1O |
| InChI | InChI=1S/C32H29N5O2.C2H6/c1-3-20-8-4-6-10-27(20)37-39-19-22-18-21-12-17-26-25-9-5-7-11-28(25)34-30(26)29(21)31(32(22)38)36-35-24-15-13-23(33-2)14-16-24;1-2/h4-18,33-34,37-38H,3,19H2,1-2H3;1-2H3/b36-35+; |
| InChIKey | GUGSKSIRNATRJH-KPYQYLATSA-N |
| XLogP | 9.77 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|